C22H23NO4 — CID 53092757
pentyl 2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxylate (PubChem CID 53092757) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is pentyl 2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxylate.
| Compound Name | pentyl 2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 53092757 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | pentyl 2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxylate |
| SMILES | CCCCCOC(=O)c1cn(-c2cccc(OC)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H23NO4/c1-3-4-7-13-27-22(25)20-15-23(16-9-8-10-17(14-16)26-2)21(24)19-12-6-5-11-18(19)20/h5-6,8-12,14-15H,3-4,7,13H2,1-2H3 |
| InChIKey | FQYNUMFRGMYYQN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|