C26H20F3NO4 — CID 53092886
(4-propoxyphenyl) 1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinoline-4-carboxylate (PubChem CID 53092886) has the molecular formula C26H20F3NO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is (4-propoxyphenyl) 1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinoline-4-carboxylate.
| Compound Name | (4-propoxyphenyl) 1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 53092886 |
| Molecular Formula | C26H20F3NO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (4-propoxyphenyl) 1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinoline-4-carboxylate |
| SMILES | CCCOc1ccc(OC(=O)c2cn(-c3cccc(C(F)(F)F)c3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H20F3NO4/c1-2-14-33-19-10-12-20(13-11-19)34-25(32)23-16-30(24(31)22-9-4-3-8-21(22)23)18-7-5-6-17(15-18)26(27,28)29/h3-13,15-16H,2,14H2,1H3 |
| InChIKey | YKDOMJPCENLPQM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|