C23H25NO4 — CID 53092826
(4-propoxyphenyl) 2-(2-methylpropyl)-1-oxoisoquinoline-4-carboxylate (PubChem CID 53092826) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (4-propoxyphenyl) 2-(2-methylpropyl)-1-oxoisoquinoline-4-carboxylate.
| Compound Name | (4-propoxyphenyl) 2-(2-methylpropyl)-1-oxoisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 53092826 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (4-propoxyphenyl) 2-(2-methylpropyl)-1-oxoisoquinoline-4-carboxylate |
| SMILES | CCCOc1ccc(OC(=O)c2cn(CC(C)C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-4-13-27-17-9-11-18(12-10-17)28-23(26)21-15-24(14-16(2)3)22(25)20-8-6-5-7-19(20)21/h5-12,15-16H,4,13-14H2,1-3H3 |
| InChIKey | JKOVWPMHXYTKDN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|