C25H25N3O2 — CID 53099574
1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(4-methylphenyl)urea (PubChem CID 53099574) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 53099574 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3c(c2)N(C(=O)c2ccccc2)C(C)C3)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-17-8-12-22(13-9-17)27-25(30)26-16-19-10-11-21-14-18(2)28(23(21)15-19)24(29)20-6-4-3-5-7-20/h3-13,15,18H,14,16H2,1-2H3,(H2,26,27,30) |
| InChIKey | NDNRLBJQLVMJER-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |