C26H27N3O2 — CID 53099590
1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(2-ethylphenyl)urea (PubChem CID 53099590) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(2-ethylphenyl)urea.
| Compound Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 53099590 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)NCc1ccc2c(c1)N(C(=O)c1ccccc1)C(C)C2 |
| InChI | InChI=1S/C26H27N3O2/c1-3-20-9-7-8-12-23(20)28-26(31)27-17-19-13-14-22-15-18(2)29(24(22)16-19)25(30)21-10-5-4-6-11-21/h4-14,16,18H,3,15,17H2,1-2H3,(H2,27,28,31) |
| InChIKey | ISYMGQHFMZVASV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |