C24H22ClN3O2 — CID 53099560
1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(3-chlorophenyl)urea (PubChem CID 53099560) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 53099560 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[(1-benzoyl-2-methyl-2,3-dihydroindol-6-yl)methyl]-3-(3-chlorophenyl)urea |
| SMILES | CC1Cc2ccc(CNC(=O)Nc3cccc(Cl)c3)cc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O2/c1-16-12-19-11-10-17(15-26-24(30)27-21-9-5-8-20(25)14-21)13-22(19)28(16)23(29)18-6-3-2-4-7-18/h2-11,13-14,16H,12,15H2,1H3,(H2,26,27,30) |
| InChIKey | MPVLXHJDSOZJFT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |