C24H21ClN2O2 — CID 95081549
N-[[(2S)-1-benzoyl-2-methyl-2,3-dihydroindol-6-yl]methyl]-3-chlorobenzamide (PubChem CID 95081549) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is N-[[(2S)-1-benzoyl-2-methyl-2,3-dihydroindol-6-yl]methyl]-3-chlorobenzamide.
| Compound Name | N-[[(2S)-1-benzoyl-2-methyl-2,3-dihydroindol-6-yl]methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 95081549 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[[(2S)-1-benzoyl-2-methyl-2,3-dihydroindol-6-yl]methyl]-3-chlorobenzamide |
| SMILES | C[C@H]1Cc2ccc(CNC(=O)c3cccc(Cl)c3)cc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-16-12-19-11-10-17(15-26-23(28)20-8-5-9-21(25)14-20)13-22(19)27(16)24(29)18-6-3-2-4-7-18/h2-11,13-14,16H,12,15H2,1H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | HCNFHSQZPDYHIC-INIZCTEOSA-N |
| XLogP | 4.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |