C23H24N2O3S2 — CID 53101533
N-[(3-methylphenyl)methyl]-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101533) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-[(3-methylphenyl)methyl]-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101533 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | Cc1cccc(CNC(=O)c2cccc(-c3ccc(S(=O)(=O)N4CCCC4)s3)c2)c1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-17-6-4-7-18(14-17)16-24-23(26)20-9-5-8-19(15-20)21-10-11-22(29-21)30(27,28)25-12-2-3-13-25/h4-11,14-15H,2-3,12-13,16H2,1H3,(H,24,26) |
| InChIKey | OLCAZGGYLVRVLB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |