C21H19FN2O3S2 — CID 53101514
N-(4-fluorophenyl)-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101514) has the molecular formula C21H19FN2O3S2 and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-(4-fluorophenyl)-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101514 |
| Molecular Formula | C21H19FN2O3S2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-(4-fluorophenyl)-3-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(-c2ccc(S(=O)(=O)N3CCCC3)s2)c1 |
| InChI | InChI=1S/C21H19FN2O3S2/c22-17-6-8-18(9-7-17)23-21(25)16-5-3-4-15(14-16)19-10-11-20(28-19)29(26,27)24-12-1-2-13-24/h3-11,14H,1-2,12-13H2,(H,23,25) |
| InChIKey | GIYNFCXHWGGVTK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |