C21H19ClN2O4S2 — CID 53101450
N-(4-chlorophenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101450) has the molecular formula C21H19ClN2O4S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-(4-chlorophenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101450 |
| Molecular Formula | C21H19ClN2O4S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | N-(4-chlorophenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C21H19ClN2O4S2/c22-17-5-7-18(8-6-17)23-21(25)16-3-1-15(2-4-16)19-9-10-20(29-19)30(26,27)24-11-13-28-14-12-24/h1-10H,11-14H2,(H,23,25) |
| InChIKey | WKBURIGQINHNOO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |