C22H20N2O6S2 — CID 53101425
N-(1,3-benzodioxol-5-yl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101425) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101425 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C22H20N2O6S2/c25-22(23-17-5-6-18-19(13-17)30-14-29-18)16-3-1-15(2-4-16)20-7-8-21(31-20)32(26,27)24-9-11-28-12-10-24/h1-8,13H,9-12,14H2,(H,23,25) |
| InChIKey | CITQFOWTBUJBCO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |