C21H18ClFN2O4S2 — CID 53101574
N-(3-chloro-4-fluorophenyl)-3-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101574) has the molecular formula C21H18ClFN2O4S2 and a molecular weight of 480.97 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101574 |
| Molecular Formula | C21H18ClFN2O4S2 |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 |
| InChI | InChI=1S/C21H18ClFN2O4S2/c22-17-13-16(4-5-18(17)23)24-21(26)15-3-1-2-14(12-15)19-6-7-20(30-19)31(27,28)25-8-10-29-11-9-25/h1-7,12-13H,8-11H2,(H,24,26) |
| InChIKey | PYNIKBYNVFWWEQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |