C23H24N2O6S2 — CID 53101455
N-(2,4-dimethoxyphenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide (PubChem CID 53101455) has the molecular formula C23H24N2O6S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 53101455 |
| Molecular Formula | C23H24N2O6S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(5-morpholin-4-ylsulfonylthiophen-2-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(S(=O)(=O)N4CCOCC4)s3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H24N2O6S2/c1-29-18-7-8-19(20(15-18)30-2)24-23(26)17-5-3-16(4-6-17)21-9-10-22(32-21)33(27,28)25-11-13-31-14-12-25/h3-10,15H,11-14H2,1-2H3,(H,24,26) |
| InChIKey | OZEGIOXTWIIDSL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |