C19H20N2O3S2 — CID 53103169
N-benzyl-5-(2-cyclopentyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 53103169) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-benzyl-5-(2-cyclopentyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-benzyl-5-(2-cyclopentyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53103169 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-benzyl-5-(2-cyclopentyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc(-c2cnc(C3CCCC3)o2)s1 |
| InChI | InChI=1S/C19H20N2O3S2/c22-26(23,21-12-14-6-2-1-3-7-14)18-11-10-17(25-18)16-13-20-19(24-16)15-8-4-5-9-15/h1-3,6-7,10-11,13,15,21H,4-5,8-9,12H2 |
| InChIKey | BMDYVHAQNKSTIW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |