C21H25N3O3S2 — CID 53103180
5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[[4-(dimethylamino)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 53103180) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[[4-(dimethylamino)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[[4-(dimethylamino)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53103180 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[[4-(dimethylamino)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | CN(C)c1ccc(CNS(=O)(=O)c2ccc(-c3cnc(C4CCCC4)o3)s2)cc1 |
| InChI | InChI=1S/C21H25N3O3S2/c1-24(2)17-9-7-15(8-10-17)13-23-29(25,26)20-12-11-19(28-20)18-14-22-21(27-18)16-5-3-4-6-16/h7-12,14,16,23H,3-6,13H2,1-2H3 |
| InChIKey | UOVLHJLZCNOFGQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|