C22H23ClN4O2S — CID 53104537
N-[(4-chlorophenyl)methyl]-6-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine (PubChem CID 53104537) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-6-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 53104537 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
| SMILES | Cc1ccc(-c2ccc(NCc3ccc(Cl)cc3)nn2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C22H23ClN4O2S/c1-16-4-7-18(14-21(16)30(28,29)27-12-2-3-13-27)20-10-11-22(26-25-20)24-15-17-5-8-19(23)9-6-17/h4-11,14H,2-3,12-13,15H2,1H3,(H,24,26) |
| InChIKey | FQTXARFLOADJAD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |