C23H26N4O3S — CID 53104720
N-(4-ethylphenyl)-6-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine (PubChem CID 53104720) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(4-ethylphenyl)-6-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine.
| Compound Name | N-(4-ethylphenyl)-6-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 53104720 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(4-ethylphenyl)-6-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)pyridazin-3-amine |
| SMILES | CCc1ccc(Nc2ccc(-c3ccc(OC)c(S(=O)(=O)N4CCCC4)c3)nn2)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-3-17-6-9-19(10-7-17)24-23-13-11-20(25-26-23)18-8-12-21(30-2)22(16-18)31(28,29)27-14-4-5-15-27/h6-13,16H,3-5,14-15H2,1-2H3,(H,24,26) |
| InChIKey | QREMLQRFBGRZPU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |