C23H23N5O2S — CID 53104600
4-[[6-(4-methyl-3-piperidin-1-ylsulfonylphenyl)pyridazin-3-yl]amino]benzonitrile (PubChem CID 53104600) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[[6-(4-methyl-3-piperidin-1-ylsulfonylphenyl)pyridazin-3-yl]amino]benzonitrile.
| Compound Name | 4-[[6-(4-methyl-3-piperidin-1-ylsulfonylphenyl)pyridazin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 53104600 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[[6-(4-methyl-3-piperidin-1-ylsulfonylphenyl)pyridazin-3-yl]amino]benzonitrile |
| SMILES | Cc1ccc(-c2ccc(Nc3ccc(C#N)cc3)nn2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H23N5O2S/c1-17-5-8-19(15-22(17)31(29,30)28-13-3-2-4-14-28)21-11-12-23(27-26-21)25-20-9-6-18(16-24)7-10-20/h5-12,15H,2-4,13-14H2,1H3,(H,25,27) |
| InChIKey | UBROCNGRZZOLRY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |