C23H33N5O — CID 53107274
N-[2-(diethylamino)ethyl]-1-[5-(3-methylphenyl)pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 53107274) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-1-[5-(3-methylphenyl)pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-1-[5-(3-methylphenyl)pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53107274 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-1-[5-(3-methylphenyl)pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)C1CCN(c2ncc(-c3cccc(C)c3)cn2)CC1 |
| InChI | InChI=1S/C23H33N5O/c1-4-27(5-2)14-11-24-22(29)19-9-12-28(13-10-19)23-25-16-21(17-26-23)20-8-6-7-18(3)15-20/h6-8,15-17,19H,4-5,9-14H2,1-3H3,(H,24,29) |
| InChIKey | IXXYAMWBTNVYBI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |