C28H37N5O3 — CID 53107672
6-[4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-1,4-diazepan-1-yl]-1,3-di(propan-2-yl)pyrimidine-2,4-dione (PubChem CID 53107672) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 6-[4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-1,4-diazepan-1-yl]-1,3-di(propan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 6-[4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-1,4-diazepan-1-yl]-1,3-di(propan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53107672 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 6-[4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]-1,4-diazepan-1-yl]-1,3-di(propan-2-yl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCCN(c3cc(=O)n(C(C)C)c(=O)n3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C28H37N5O3/c1-19(2)31-25(18-26(34)32(20(3)4)28(31)36)29-14-7-15-30(17-16-29)27(35)23-10-12-24(13-11-23)33-21(5)8-9-22(33)6/h8-13,18-20H,7,14-17H2,1-6H3 |
| InChIKey | RRPRMZOOUQJXKK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|