C23H24ClN5OS — CID 53108909
N-[(4-chlorophenyl)methyl]-2-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 53108909) has the molecular formula C23H24ClN5OS and a molecular weight of 454.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53108909 |
| Molecular Formula | C23H24ClN5OS |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(N2CCN(c3ccccc3)CC2)nn1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN5OS/c24-19-8-6-18(7-9-19)16-25-22(30)17-31-23-11-10-21(26-27-23)29-14-12-28(13-15-29)20-4-2-1-3-5-20/h1-11H,12-17H2,(H,25,30) |
| InChIKey | AAUHGFCPKFXEEB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |