C24H26FN5OS — CID 53108952
N-(4-ethylphenyl)-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]sulfanylacetamide (PubChem CID 53108952) has the molecular formula C24H26FN5OS and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-ethylphenyl)-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53108952 |
| Molecular Formula | C24H26FN5OS |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-(4-ethylphenyl)-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]sulfanylacetamide |
| SMILES | CCc1ccc(NC(=O)CSc2ccc(N3CCN(c4ccc(F)cc4)CC3)nn2)cc1 |
| InChI | InChI=1S/C24H26FN5OS/c1-2-18-3-7-20(8-4-18)26-23(31)17-32-24-12-11-22(27-28-24)30-15-13-29(14-16-30)21-9-5-19(25)6-10-21/h3-12H,2,13-17H2,1H3,(H,26,31) |
| InChIKey | HDVUZIAPNUOGEF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |