C10H5ClF4N2O — CID 5311734
3-(chloromethyl)-5-[2-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 5311734) has the molecular formula C10H5ClF4N2O and a molecular weight of 280.61 g/mol. Its IUPAC name is 3-(chloromethyl)-5-[2-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(chloromethyl)-5-[2-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 5311734 |
| Molecular Formula | C10H5ClF4N2O |
| Molecular Weight | 280.61 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 3-(chloromethyl)-5-[2-fluoro-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc(C(F)(F)F)cc1-c1nc(CCl)no1 |
| InChI | InChI=1S/C10H5ClF4N2O/c11-4-8-16-9(18-17-8)6-3-5(10(13,14)15)1-2-7(6)12/h1-3H,4H2 |
| InChIKey | CSIWLHRNWBWEQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|