About dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane
dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane (PubChem CID 531253) has the molecular formula C13H22Cl2OSi
and a molecular weight of 293.31 g/mol. Its IUPAC name is dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane.
Molecular Properties
| Compound Name | dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane |
| PubChem CID | 531253 |
| Molecular Formula | C13H22Cl2OSi |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](C)(C)C(Cl)Cl |
| InChI | InChI=1S/C13H22Cl2OSi/c1-10(2)7-8-12(9-11(3)4)16-17(5,6)13(14)15/h11-13H,1,9H2,2-6H3 |
| InChIKey | VJNAVIMJHIWBFN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane?
The IUPAC name of dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane (CID 531253) is dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane.
What is the SMILES notation for dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane?
The canonical SMILES for dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane is C=C(C)C#CC(CC(C)C)O[Si](C)(C)C(Cl)Cl.
What is the InChIKey of dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane?
The InChIKey is VJNAVIMJHIWBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22Cl2OSi/c1-10(2)7-8-12(9-11(3)4)16-17(5,6)13(14)15/h11-13H,1,9H2,2-6H3.
What are the key properties of dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane?
dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane has a molecular weight of 293.31 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethyl-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-dimethylsilane is sourced from PubChem (CID 531253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).