About dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane
dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane (PubChem CID 531254) has the molecular formula C14H24Cl2OSi
and a molecular weight of 307.34 g/mol. Its IUPAC name is dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane.
Molecular Properties
| Compound Name | dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane |
| PubChem CID | 531254 |
| Molecular Formula | C14H24Cl2OSi |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane |
| SMILES | C=C(C)C#CC(O[Si](C)(C)C(Cl)Cl)C(C)CCC |
| InChI | InChI=1S/C14H24Cl2OSi/c1-7-8-12(4)13(10-9-11(2)3)17-18(5,6)14(15)16/h12-14H,2,7-8H2,1,3-6H3 |
| InChIKey | MCADYWSYHFNHDE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The IUPAC name of dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane (CID 531254) is dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane.
What is the SMILES notation for dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The canonical SMILES for dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane is C=C(C)C#CC(O[Si](C)(C)C(Cl)Cl)C(C)CCC.
What is the InChIKey of dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The InChIKey is MCADYWSYHFNHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24Cl2OSi/c1-7-8-12(4)13(10-9-11(2)3)17-18(5,6)14(15)16/h12-14H,2,7-8H2,1,3-6H3.
What are the key properties of dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane has a molecular weight of 307.34 g/mol, XLogP of 4.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane is sourced from PubChem (CID 531254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).