C15H28O2Si — CID 91732395
2,6-dimethylnon-1-en-3-yn-5-yloxy-ethoxy-dimethylsilane (PubChem CID 91732395) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yloxy-ethoxy-dimethylsilane.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yloxy-ethoxy-dimethylsilane |
|---|---|
| PubChem CID | 91732395 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yloxy-ethoxy-dimethylsilane |
| SMILES | C=C(C)C#CC(O[Si](C)(C)OCC)C(C)CCC |
| InChI | InChI=1S/C15H28O2Si/c1-8-10-14(5)15(12-11-13(3)4)17-18(6,7)16-9-2/h14-15H,3,8-10H2,1-2,4-7H3 |
| InChIKey | QCMCCJRLCXRSNF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|