C15H27ClOSi — CID 91735032
chloro-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-diethylsilane (PubChem CID 91735032) has the molecular formula C15H27ClOSi and a molecular weight of 286.92 g/mol. Its IUPAC name is chloro-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-diethylsilane.
| Compound Name | chloro-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-diethylsilane |
|---|---|
| PubChem CID | 91735032 |
| Molecular Formula | C15H27ClOSi |
| Molecular Weight | 286.92 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | chloro-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-diethylsilane |
| SMILES | C=C(C)C#CC(O[Si](Cl)(CC)CC)C(C)CCC |
| InChI | InChI=1S/C15H27ClOSi/c1-7-10-14(6)15(12-11-13(4)5)17-18(16,8-2)9-3/h14-15H,4,7-10H2,1-3,5-6H3 |
| InChIKey | MUHRBGAYVLUHSG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|