C22H21N3O3S — CID 53125581
3-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile (PubChem CID 53125581) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile.
| Compound Name | 3-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 53125581 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
| SMILES | CC1CCN(C(=O)C2=CN(c3cccc(C#N)c3)c3ccccc3S2(=O)=O)CC1 |
| InChI | InChI=1S/C22H21N3O3S/c1-16-9-11-24(12-10-16)22(26)21-15-25(18-6-4-5-17(13-18)14-23)19-7-2-3-8-20(19)29(21,27)28/h2-8,13,15-16H,9-12H2,1H3 |
| InChIKey | XCXXRTZVYYNYQA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|