C22H20ClN3O3S — CID 53125657
3-[6-chloro-2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile (PubChem CID 53125657) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 3-[6-chloro-2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile.
| Compound Name | 3-[6-chloro-2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 53125657 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3-[6-chloro-2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
| SMILES | CC1CCN(C(=O)C2=CN(c3cccc(C#N)c3)c3cc(Cl)ccc3S2(=O)=O)CC1 |
| InChI | InChI=1S/C22H20ClN3O3S/c1-15-7-9-25(10-8-15)22(27)21-14-26(18-4-2-3-16(11-18)13-24)19-12-17(23)5-6-20(19)30(21,28)29/h2-6,11-12,14-15H,7-10H2,1H3 |
| InChIKey | MDBVZZVWIKVCCW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|