C17H20ClN3O3S — CID 53151583
(7-chloro-4,4-dioxo-1-prop-2-enyl-4λ6,1,2-benzothiadiazin-3-yl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 53151583) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is (7-chloro-4,4-dioxo-1-prop-2-enyl-4λ6,1,2-benzothiadiazin-3-yl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (7-chloro-4,4-dioxo-1-prop-2-enyl-4λ6,1,2-benzothiadiazin-3-yl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53151583 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (7-chloro-4,4-dioxo-1-prop-2-enyl-4λ6,1,2-benzothiadiazin-3-yl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | C=CCN1N=C(C(=O)N2CCC(C)CC2)S(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-3-8-21-14-11-13(18)4-5-15(14)25(23,24)16(19-21)17(22)20-9-6-12(2)7-10-20/h3-5,11-12H,1,6-10H2,2H3 |
| InChIKey | HIHKOVTZRSOGEJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|