C24H26N2O3S — CID 28592249
(2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazin-3-yl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 28592249) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazin-3-yl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazin-3-yl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 28592249 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazin-3-yl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | C=CCN1c2ccccc2C(c2ccccc2)=C(C(=O)N2CCC(C)CC2)S1(=O)=O |
| InChI | InChI=1S/C24H26N2O3S/c1-3-15-26-21-12-8-7-11-20(21)22(19-9-5-4-6-10-19)23(30(26,28)29)24(27)25-16-13-18(2)14-17-25/h3-12,18H,1,13-17H2,2H3 |
| InChIKey | ORJINIGWGPOANO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|