C24H18Cl2N2O3S — CID 28592546
6-chloro-N-(2-chlorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592546) has the molecular formula C24H18Cl2N2O3S and a molecular weight of 485.39 g/mol. Its IUPAC name is 6-chloro-N-(2-chlorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-chlorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592546 |
| Molecular Formula | C24H18Cl2N2O3S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 6-chloro-N-(2-chlorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2ccc(Cl)cc2C(c2ccccc2)=C(C(=O)Nc2ccccc2Cl)S1(=O)=O |
| InChI | InChI=1S/C24H18Cl2N2O3S/c1-2-14-28-21-13-12-17(25)15-18(21)22(16-8-4-3-5-9-16)23(32(28,30)31)24(29)27-20-11-7-6-10-19(20)26/h2-13,15H,1,14H2,(H,27,29) |
| InChIKey | ADEQFXFYTIYMIO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|