C26H21ClN2O4S — CID 28592580
N-(3-acetylphenyl)-6-chloro-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592580) has the molecular formula C26H21ClN2O4S and a molecular weight of 492.98 g/mol. Its IUPAC name is N-(3-acetylphenyl)-6-chloro-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | N-(3-acetylphenyl)-6-chloro-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592580 |
| Molecular Formula | C26H21ClN2O4S |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-(3-acetylphenyl)-6-chloro-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2ccc(Cl)cc2C(c2ccccc2)=C(C(=O)Nc2cccc(C(C)=O)c2)S1(=O)=O |
| InChI | InChI=1S/C26H21ClN2O4S/c1-3-14-29-23-13-12-20(27)16-22(23)24(18-8-5-4-6-9-18)25(34(29,32)33)26(31)28-21-11-7-10-19(15-21)17(2)30/h3-13,15-16H,1,14H2,2H3,(H,28,31) |
| InChIKey | OGXVWVRAZCSMNO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|