C24H17ClF2N2O3S — CID 28592572
6-chloro-N-(2,4-difluorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592572) has the molecular formula C24H17ClF2N2O3S and a molecular weight of 486.93 g/mol. Its IUPAC name is 6-chloro-N-(2,4-difluorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | 6-chloro-N-(2,4-difluorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592572 |
| Molecular Formula | C24H17ClF2N2O3S |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 6-chloro-N-(2,4-difluorophenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2ccc(Cl)cc2C(c2ccccc2)=C(C(=O)Nc2ccc(F)cc2F)S1(=O)=O |
| InChI | InChI=1S/C24H17ClF2N2O3S/c1-2-12-29-21-11-8-16(25)13-18(21)22(15-6-4-3-5-7-15)23(33(29,31)32)24(30)28-20-10-9-17(26)14-19(20)27/h2-11,13-14H,1,12H2,(H,28,30) |
| InChIKey | SDHCJDTXMSXPKF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|