C27H24N2O5S — CID 28592292
ethyl 4-[(2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carbonyl)amino]benzoate (PubChem CID 28592292) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is ethyl 4-[(2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 28592292 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | ethyl 4-[(2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carbonyl)amino]benzoate |
| SMILES | C=CCN1c2ccccc2C(c2ccccc2)=C(C(=O)Nc2ccc(C(=O)OCC)cc2)S1(=O)=O |
| InChI | InChI=1S/C27H24N2O5S/c1-3-18-29-23-13-9-8-12-22(23)24(19-10-6-5-7-11-19)25(35(29,32)33)26(30)28-21-16-14-20(15-17-21)27(31)34-4-2/h3,5-17H,1,4,18H2,2H3,(H,28,30) |
| InChIKey | TXYGNYOHMDLPBS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|