C31H26N2O4S — CID 28592310
2,2-dioxo-4-phenyl-N-(4-phenylmethoxyphenyl)-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592310) has the molecular formula C31H26N2O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is 2,2-dioxo-4-phenyl-N-(4-phenylmethoxyphenyl)-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | 2,2-dioxo-4-phenyl-N-(4-phenylmethoxyphenyl)-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592310 |
| Molecular Formula | C31H26N2O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2,2-dioxo-4-phenyl-N-(4-phenylmethoxyphenyl)-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2ccccc2C(c2ccccc2)=C(C(=O)Nc2ccc(OCc3ccccc3)cc2)S1(=O)=O |
| InChI | InChI=1S/C31H26N2O4S/c1-2-21-33-28-16-10-9-15-27(28)29(24-13-7-4-8-14-24)30(38(33,35)36)31(34)32-25-17-19-26(20-18-25)37-22-23-11-5-3-6-12-23/h2-20H,1,21-22H2,(H,32,34) |
| InChIKey | GAHKRMWLFVXYJH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|