C26H22N2O4S — CID 28592321
N-(3-acetylphenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28592321) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28592321 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-(3-acetylphenyl)-2,2-dioxo-4-phenyl-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2ccccc2C(c2ccccc2)=C(C(=O)Nc2cccc(C(C)=O)c2)S1(=O)=O |
| InChI | InChI=1S/C26H22N2O4S/c1-3-16-28-23-15-8-7-14-22(23)24(19-10-5-4-6-11-19)25(33(28,31)32)26(30)27-21-13-9-12-20(17-21)18(2)29/h3-15,17H,1,16H2,2H3,(H,27,30) |
| InChIKey | USAPLSFEOXJQAF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|