C21H27N5O4S — CID 53151547
[7-methyl-4,4-dioxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-4λ6,1,2-benzothiadiazin-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 53151547) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is [7-methyl-4,4-dioxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-4λ6,1,2-benzothiadiazin-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [7-methyl-4,4-dioxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-4λ6,1,2-benzothiadiazin-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53151547 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [7-methyl-4,4-dioxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-4λ6,1,2-benzothiadiazin-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCCc1noc(CN2N=C(C(=O)N3CCC(C)CC3)S(=O)(=O)c3ccc(C)cc32)n1 |
| InChI | InChI=1S/C21H27N5O4S/c1-4-5-18-22-19(30-24-18)13-26-16-12-15(3)6-7-17(16)31(28,29)20(23-26)21(27)25-10-8-14(2)9-11-25/h6-7,12,14H,4-5,8-11,13H2,1-3H3 |
| InChIKey | RHJDAKVTDDFRDG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |