C24H26N2O5S — CID 53125582
ethyl 4-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzoate (PubChem CID 53125582) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is ethyl 4-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzoate.
| Compound Name | ethyl 4-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzoate |
|---|---|
| PubChem CID | 53125582 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | ethyl 4-[2-(4-methylpiperidine-1-carbonyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C=C(C(=O)N3CCC(C)CC3)S(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H26N2O5S/c1-3-31-24(28)18-8-10-19(11-9-18)26-16-22(23(27)25-14-12-17(2)13-15-25)32(29,30)21-7-5-4-6-20(21)26/h4-11,16-17H,3,12-15H2,1-2H3 |
| InChIKey | RJXJUAAISSYSHD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|