C18H14N2O4S — CID 53125295
ethyl 4-(2-cyano-1,1-dioxo-1λ6,4-benzothiazin-4-yl)benzoate (PubChem CID 53125295) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is ethyl 4-(2-cyano-1,1-dioxo-1λ6,4-benzothiazin-4-yl)benzoate.
| Compound Name | ethyl 4-(2-cyano-1,1-dioxo-1λ6,4-benzothiazin-4-yl)benzoate |
|---|---|
| PubChem CID | 53125295 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | ethyl 4-(2-cyano-1,1-dioxo-1λ6,4-benzothiazin-4-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C=C(C#N)S(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H14N2O4S/c1-2-24-18(21)13-7-9-14(10-8-13)20-12-15(11-19)25(22,23)17-6-4-3-5-16(17)20/h3-10,12H,2H2,1H3 |
| InChIKey | FQVPFVHPRRTERB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |