C19H16F2N2O4S — CID 53125597
[4-(3,5-difluorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone (PubChem CID 53125597) has the molecular formula C19H16F2N2O4S and a molecular weight of 406.41 g/mol. Its IUPAC name is [4-(3,5-difluorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(3,5-difluorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53125597 |
| Molecular Formula | C19H16F2N2O4S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [4-(3,5-difluorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1=CN(c2cc(F)cc(F)c2)c2ccccc2S1(=O)=O)N1CCOCC1 |
| InChI | InChI=1S/C19H16F2N2O4S/c20-13-9-14(21)11-15(10-13)23-12-18(19(24)22-5-7-27-8-6-22)28(25,26)17-4-2-1-3-16(17)23/h1-4,9-12H,5-8H2 |
| InChIKey | HDXQLPPLJQEORP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|