C19H15Cl3N2O4S — CID 91887055
[6-chloro-4-(3,4-dichlorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone (PubChem CID 91887055) has the molecular formula C19H15Cl3N2O4S and a molecular weight of 473.77 g/mol. Its IUPAC name is [6-chloro-4-(3,4-dichlorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-chloro-4-(3,4-dichlorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 91887055 |
| Molecular Formula | C19H15Cl3N2O4S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | [6-chloro-4-(3,4-dichlorophenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1=CN(c2ccc(Cl)c(Cl)c2)c2cc(Cl)ccc2S1(=O)=O)N1CCOCC1 |
| InChI | InChI=1S/C19H15Cl3N2O4S/c20-12-1-4-17-16(9-12)24(13-2-3-14(21)15(22)10-13)11-18(29(17,26)27)19(25)23-5-7-28-8-6-23/h1-4,9-11H,5-8H2 |
| InChIKey | GIQZITMDKNKEEL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|