C15H15N3O3S2 — CID 53130905
N-(2-methoxy-5-methylphenyl)-4-(1H-pyrazol-5-yl)thiophene-2-sulfonamide (PubChem CID 53130905) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-4-(1H-pyrazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-4-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53130905 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-4-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(C)cc1NS(=O)(=O)c1cc(-c2ccn[nH]2)cs1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-10-3-4-14(21-2)13(7-10)18-23(19,20)15-8-11(9-22-15)12-5-6-16-17-12/h3-9,18H,1-2H3,(H,16,17) |
| InChIKey | ZKLSINKNTYMTFD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |