C14H12N2O4S2 — CID 51048851
N-(2-methoxyphenyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 51048851) has the molecular formula C14H12N2O4S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-methoxyphenyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 51048851 |
| Molecular Formula | C14H12N2O4S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-(2-methoxyphenyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(-c2ccno2)cs1 |
| InChI | InChI=1S/C14H12N2O4S2/c1-19-13-5-3-2-4-11(13)16-22(17,18)14-8-10(9-21-14)12-6-7-15-20-12/h2-9,16H,1H3 |
| InChIKey | YMPHEXKEWHKAFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |