C13H11N3O5S3 — CID 46393001
4-(1,2-oxazol-5-yl)-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 46393001) has the molecular formula C13H11N3O5S3 and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-(1,2-oxazol-5-yl)-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(1,2-oxazol-5-yl)-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46393001 |
| Molecular Formula | C13H11N3O5S3 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 4-(1,2-oxazol-5-yl)-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2cc(-c3ccno3)cs2)cc1 |
| InChI | InChI=1S/C13H11N3O5S3/c14-23(17,18)11-3-1-10(2-4-11)16-24(19,20)13-7-9(8-22-13)12-5-6-15-21-12/h1-8,16H,(H2,14,17,18) |
| InChIKey | QJIURUAQGLPNDH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |