About N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide
N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 46393004) has the molecular formula C12H16N2O4S2
and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| PubChem CID | 46393004 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | CCOCCCNS(=O)(=O)c1cc(-c2ccno2)cs1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-2-17-7-3-5-14-20(15,16)12-8-10(9-19-12)11-4-6-13-18-11/h4,6,8-9,14H,2-3,5,7H2,1H3 |
| InChIKey | NUBXOBJDOUXHTM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide?
The IUPAC name of N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide (CID 46393004) is N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide.
What is the SMILES notation for N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide?
The canonical SMILES for N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide is CCOCCCNS(=O)(=O)c1cc(-c2ccno2)cs1.
What is the InChIKey of N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide?
The InChIKey is NUBXOBJDOUXHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4S2/c1-2-17-7-3-5-14-20(15,16)12-8-10(9-19-12)11-4-6-13-18-11/h4,6,8-9,14H,2-3,5,7H2,1H3.
What are the key properties of N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide?
N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide has a molecular weight of 316.40 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxypropyl)-4-(1,2-oxazol-5-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 46393004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).