C22H28N4O3S2 — CID 50835113
4-(3-ethyl-1,2-oxazol-5-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-sulfonamide (PubChem CID 50835113) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 4-(3-ethyl-1,2-oxazol-5-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 4-(3-ethyl-1,2-oxazol-5-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50835113 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-(3-ethyl-1,2-oxazol-5-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-sulfonamide |
| SMILES | CCc1cc(-c2csc(S(=O)(=O)NCCCN3CCN(c4ccccc4)CC3)c2)on1 |
| InChI | InChI=1S/C22H28N4O3S2/c1-2-19-16-21(29-24-19)18-15-22(30-17-18)31(27,28)23-9-6-10-25-11-13-26(14-12-25)20-7-4-3-5-8-20/h3-5,7-8,15-17,23H,2,6,9-14H2,1H3 |
| InChIKey | JUCIVEGHECUPBW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|