C20H20N2O2S — CID 53134849
5-benzyl-2-(piperidine-1-carbonyl)thieno[3,2-c]pyridin-4-one (PubChem CID 53134849) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 5-benzyl-2-(piperidine-1-carbonyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-benzyl-2-(piperidine-1-carbonyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 53134849 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-benzyl-2-(piperidine-1-carbonyl)thieno[3,2-c]pyridin-4-one |
| SMILES | O=C(c1cc2c(=O)n(Cc3ccccc3)ccc2s1)N1CCCCC1 |
| InChI | InChI=1S/C20H20N2O2S/c23-19-16-13-18(20(24)21-10-5-2-6-11-21)25-17(16)9-12-22(19)14-15-7-3-1-4-8-15/h1,3-4,7-9,12-13H,2,5-6,10-11,14H2 |
| InChIKey | KFPYJWCVGRGFQA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |