C21H32O3 — CID 5314045
methyl (4aS,4bR)-1,1,4b,8,8-pentamethyl-4-oxo-3,5,6,7,10,10a-hexahydro-2H-phenanthrene-4a-carboxylate (PubChem CID 5314045) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl (4aS,4bR)-1,1,4b,8,8-pentamethyl-4-oxo-3,5,6,7,10,10a-hexahydro-2H-phenanthrene-4a-carboxylate.
| Compound Name | methyl (4aS,4bR)-1,1,4b,8,8-pentamethyl-4-oxo-3,5,6,7,10,10a-hexahydro-2H-phenanthrene-4a-carboxylate |
|---|---|
| PubChem CID | 5314045 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl (4aS,4bR)-1,1,4b,8,8-pentamethyl-4-oxo-3,5,6,7,10,10a-hexahydro-2H-phenanthrene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC(C)(C)C1CC=C1C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C21H32O3/c1-18(2)11-7-12-20(5)14(18)8-9-15-19(3,4)13-10-16(22)21(15,20)17(23)24-6/h8,15H,7,9-13H2,1-6H3/t15?,20-,21+/m1/s1 |
| InChIKey | QRCBEJZZNNZZGK-CGDWMNPFSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|