C19H22N4O2S — CID 53141279
4-acetamido-N-[2-(cyclohexen-1-yl)ethyl]-3-pyridin-2-yl-1,2-thiazole-5-carboxamide (PubChem CID 53141279) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-acetamido-N-[2-(cyclohexen-1-yl)ethyl]-3-pyridin-2-yl-1,2-thiazole-5-carboxamide.
| Compound Name | 4-acetamido-N-[2-(cyclohexen-1-yl)ethyl]-3-pyridin-2-yl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53141279 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-acetamido-N-[2-(cyclohexen-1-yl)ethyl]-3-pyridin-2-yl-1,2-thiazole-5-carboxamide |
| SMILES | CC(=O)Nc1c(-c2ccccn2)nsc1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(24)22-17-16(15-9-5-6-11-20-15)23-26-18(17)19(25)21-12-10-14-7-3-2-4-8-14/h5-7,9,11H,2-4,8,10,12H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | YZWKHVXUXXGAKU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|